C23H37NO2 — CID 67024815
(8R,9R,10R,13S,14S)-10,13-dimethyl-17-pyrrolidin-1-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 67024815) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-10,13-dimethyl-17-pyrrolidin-1-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-17-pyrrolidin-1-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 67024815 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | (8R,9R,10R,13S,14S)-10,13-dimethyl-17-pyrrolidin-1-yl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | C[C@]12CCC(O)CC1=CC[C@@H]1[C@H]2CC[C@]2(C)C(N3CCCC3)C(O)C[C@@H]12 |
| InChI | InChI=1S/C23H37NO2/c1-22-9-7-16(25)13-15(22)5-6-17-18(22)8-10-23(2)19(17)14-20(26)21(23)24-11-3-4-12-24/h5,16-21,25-26H,3-4,6-14H2,1-2H3/t16?,17-,18-,19+,20?,21?,22+,23+/m1/s1 |
| InChIKey | ONNFTTSFWKPICO-YFJHDHOOSA-N |
| XLogP | 3.75 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|