C24H40N2O2 — CID 3810075
10,13-dimethyl-16-(4-methylpiperazin-1-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 3810075) has the molecular formula C24H40N2O2 and a molecular weight of 388.60 g/mol. Its IUPAC name is 10,13-dimethyl-16-(4-methylpiperazin-1-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | 10,13-dimethyl-16-(4-methylpiperazin-1-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 3810075 |
| Molecular Formula | C24H40N2O2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.31 |
| IUPAC Name | 10,13-dimethyl-16-(4-methylpiperazin-1-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CN1CCN(C2CC3C4CC=C5CC(O)CCC5(C)C4CCC3(C)C2O)CC1 |
| InChI | InChI=1S/C24H40N2O2/c1-23-8-6-17(27)14-16(23)4-5-18-19(23)7-9-24(2)20(18)15-21(22(24)28)26-12-10-25(3)11-13-26/h4,17-22,27-28H,5-15H2,1-3H3 |
| InChIKey | RKWUYOJWRZWYOD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|