C27H36N2O — CID 132514309
(1S,2S,4R,8S,9S,12S,13R,16S)-7,9,13-trimethyl-5-phenyl-5,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-ol (PubChem CID 132514309) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is (1S,2S,4R,8S,9S,12S,13R,16S)-7,9,13-trimethyl-5-phenyl-5,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-ol.
| Compound Name | (1S,2S,4R,8S,9S,12S,13R,16S)-7,9,13-trimethyl-5-phenyl-5,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-ol |
|---|---|
| PubChem CID | 132514309 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (1S,2S,4R,8S,9S,12S,13R,16S)-7,9,13-trimethyl-5-phenyl-5,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-ol |
| SMILES | CC1=NN(c2ccccc2)[C@@H]2C[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]12 |
| InChI | InChI=1S/C27H36N2O/c1-17-25-24(29(28-17)19-7-5-4-6-8-19)16-23-21-10-9-18-15-20(30)11-13-26(18,2)22(21)12-14-27(23,25)3/h4-9,20-25,30H,10-16H2,1-3H3/t20-,21+,22-,23-,24+,25+,26-,27-/m0/s1 |
| InChIKey | GWMNOMFVEBCDOZ-BUSHEVSOSA-N |
| XLogP | 5.80 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|