C29H40N2O — CID 132514306
(1S,2S,4R,8S,9S,12S,13R,16S)-5-(2,4-dimethylphenyl)-7,9,13-trimethyl-5,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-ol (PubChem CID 132514306) has the molecular formula C29H40N2O and a molecular weight of 432.65 g/mol. Its IUPAC name is (1S,2S,4R,8S,9S,12S,13R,16S)-5-(2,4-dimethylphenyl)-7,9,13-trimethyl-5,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-ol.
| Compound Name | (1S,2S,4R,8S,9S,12S,13R,16S)-5-(2,4-dimethylphenyl)-7,9,13-trimethyl-5,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-ol |
|---|---|
| PubChem CID | 132514306 |
| Molecular Formula | C29H40N2O |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.31 |
| IUPAC Name | (1S,2S,4R,8S,9S,12S,13R,16S)-5-(2,4-dimethylphenyl)-7,9,13-trimethyl-5,6-diazapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-ol |
| SMILES | CC1=NN(c2ccc(C)cc2C)[C@@H]2C[C@H]3[C@@H]4CC=C5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]3(C)[C@H]12 |
| InChI | InChI=1S/C29H40N2O/c1-17-6-9-25(18(2)14-17)31-26-16-24-22-8-7-20-15-21(32)10-12-28(20,4)23(22)11-13-29(24,5)27(26)19(3)30-31/h6-7,9,14,21-24,26-27,32H,8,10-13,15-16H2,1-5H3/t21-,22+,23-,24-,26+,27+,28-,29-/m0/s1 |
| InChIKey | SSCPCJJXYWUURI-ZCWUWMNMSA-N |
| XLogP | 6.42 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|