C13H19N2O4- — CID 163138462
2-(dihydroxyamino)-4-[2-(3-methylbutanoylamino)ethyl]phenolate (PubChem CID 163138462) has the molecular formula C13H19N2O4- and a molecular weight of 267.31 g/mol. Its IUPAC name is 2-(dihydroxyamino)-4-[2-(3-methylbutanoylamino)ethyl]phenolate.
| Compound Name | 2-(dihydroxyamino)-4-[2-(3-methylbutanoylamino)ethyl]phenolate |
|---|---|
| PubChem CID | 163138462 |
| Molecular Formula | C13H19N2O4- |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-(dihydroxyamino)-4-[2-(3-methylbutanoylamino)ethyl]phenolate |
| SMILES | CC(C)CC(=O)NCCc1ccc([O-])c(N(O)O)c1 |
| InChI | InChI=1S/C13H20N2O4/c1-9(2)7-13(17)14-6-5-10-3-4-12(16)11(8-10)15(18)19/h3-4,8-9,16,18-19H,5-7H2,1-2H3,(H,14,17)/p-1 |
| InChIKey | OCQVVTUOXSSOCI-UHFFFAOYSA-M |
| XLogP | 1.05 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|