C18H26N2O5 — CID 10545803
[4-[2-(3-methylbutanoylamino)ethyl]-2-nitrophenyl] 3-methylbutanoate (PubChem CID 10545803) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is [4-[2-(3-methylbutanoylamino)ethyl]-2-nitrophenyl] 3-methylbutanoate.
| Compound Name | [4-[2-(3-methylbutanoylamino)ethyl]-2-nitrophenyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 10545803 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [4-[2-(3-methylbutanoylamino)ethyl]-2-nitrophenyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)NCCc1ccc(OC(=O)CC(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H26N2O5/c1-12(2)9-17(21)19-8-7-14-5-6-16(15(11-14)20(23)24)25-18(22)10-13(3)4/h5-6,11-13H,7-10H2,1-4H3,(H,19,21) |
| InChIKey | BXLLBWMGODNDFX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|