C16H22N2O5 — CID 10496066
[4-[2-(2-methylpropanoylamino)ethyl]-2-nitrophenyl] 2-methylpropanoate (PubChem CID 10496066) has the molecular formula C16H22N2O5 and a molecular weight of 322.36 g/mol. Its IUPAC name is [4-[2-(2-methylpropanoylamino)ethyl]-2-nitrophenyl] 2-methylpropanoate.
| Compound Name | [4-[2-(2-methylpropanoylamino)ethyl]-2-nitrophenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 10496066 |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [4-[2-(2-methylpropanoylamino)ethyl]-2-nitrophenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)NCCc1ccc(OC(=O)C(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H22N2O5/c1-10(2)15(19)17-8-7-12-5-6-14(13(9-12)18(21)22)23-16(20)11(3)4/h5-6,9-11H,7-8H2,1-4H3,(H,17,19) |
| InChIKey | HONOFWWWYXHBLN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|