C18H26N2O5 — CID 143538894
[4-(3,4-diamino-4-oxobutyl)-2-(2-methylpropanoyloxy)phenyl] 2-methylpropanoate (PubChem CID 143538894) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is [4-(3,4-diamino-4-oxobutyl)-2-(2-methylpropanoyloxy)phenyl] 2-methylpropanoate.
| Compound Name | [4-(3,4-diamino-4-oxobutyl)-2-(2-methylpropanoyloxy)phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 143538894 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | [4-(3,4-diamino-4-oxobutyl)-2-(2-methylpropanoyloxy)phenyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccc(CCC(N)C(N)=O)cc1OC(=O)C(C)C |
| InChI | InChI=1S/C18H26N2O5/c1-10(2)17(22)24-14-8-6-12(5-7-13(19)16(20)21)9-15(14)25-18(23)11(3)4/h6,8-11,13H,5,7,19H2,1-4H3,(H2,20,21) |
| InChIKey | FSOLUUVQVWCRSY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|