C14H17N3O5 — CID 163138479
5-[(1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl)methyl]-N,2-dihydroxybenzeneamine oxide (PubChem CID 163138479) has the molecular formula C14H17N3O5 and a molecular weight of 307.31 g/mol. Its IUPAC name is 5-[(1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl)methyl]-N,2-dihydroxybenzeneamine oxide.
| Compound Name | 5-[(1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl)methyl]-N,2-dihydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163138479 |
| Molecular Formula | C14H17N3O5 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 5-[(1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-yl)methyl]-N,2-dihydroxybenzeneamine oxide |
| SMILES | O=C1NC(Cc2ccc(O)c([NH+]([O-])O)c2)C(=O)N2CCCC12 |
| InChI | InChI=1S/C14H17N3O5/c18-12-4-3-8(7-11(12)17(21)22)6-9-14(20)16-5-1-2-10(16)13(19)15-9/h3-4,7,9-10,17-18,21H,1-2,5-6H2,(H,15,19) |
| InChIKey | IWNDYBJAHKWRLO-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|