C13H20N4O5 — CID 163138914
5-(cyclohexylcarbamoylamino)-1-N,3-N-dihydroxybenzene-1,3-diamine oxide (PubChem CID 163138914) has the molecular formula C13H20N4O5 and a molecular weight of 312.33 g/mol. Its IUPAC name is 5-(cyclohexylcarbamoylamino)-1-N,3-N-dihydroxybenzene-1,3-diamine oxide.
| Compound Name | 5-(cyclohexylcarbamoylamino)-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
|---|---|
| PubChem CID | 163138914 |
| Molecular Formula | C13H20N4O5 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 5-(cyclohexylcarbamoylamino)-1-N,3-N-dihydroxybenzene-1,3-diamine oxide |
| SMILES | O=C(Nc1cc([NH+]([O-])O)cc([NH+]([O-])O)c1)NC1CCCCC1 |
| InChI | InChI=1S/C13H20N4O5/c18-13(14-9-4-2-1-3-5-9)15-10-6-11(16(19)20)8-12(7-10)17(21)22/h6-9,16-17,19,21H,1-5H2,(H2,14,15,18) |
| InChIKey | JAJTXFSJNRSFOT-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|