C18H33N2O+ — CID 163141124
1-cyclohexyl-2-(1-ethyl-6-methyl-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone (PubChem CID 163141124) has the molecular formula C18H33N2O+ and a molecular weight of 293.48 g/mol. Its IUPAC name is 1-cyclohexyl-2-(1-ethyl-6-methyl-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone.
| Compound Name | 1-cyclohexyl-2-(1-ethyl-6-methyl-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone |
|---|---|
| PubChem CID | 163141124 |
| Molecular Formula | C18H33N2O+ |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | 1-cyclohexyl-2-(1-ethyl-6-methyl-1,2,3,4,6,7,8,8a-octahydropyrrolo[1,2-a]pyrazin-2-ium-2-yl)ethanone |
| SMILES | CCC1C2CCC(C)N2CC[NH+]1CC(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H32N2O/c1-3-16-17-10-9-14(2)20(17)12-11-19(16)13-18(21)15-7-5-4-6-8-15/h14-17H,3-13H2,1-2H3/p+1 |
| InChIKey | PDTNCXQAROJSAV-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |