C24H31N4O2+ — CID 163141993
ethyl (9aR)-7,9a-dimethyl-1-(4-methylphenyl)-8-phenyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-ium-3-carboxylate (PubChem CID 163141993) has the molecular formula C24H31N4O2+ and a molecular weight of 407.54 g/mol. Its IUPAC name is ethyl (9aR)-7,9a-dimethyl-1-(4-methylphenyl)-8-phenyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-ium-3-carboxylate.
| Compound Name | ethyl (9aR)-7,9a-dimethyl-1-(4-methylphenyl)-8-phenyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-ium-3-carboxylate |
|---|---|
| PubChem CID | 163141993 |
| Molecular Formula | C24H31N4O2+ |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | ethyl (9aR)-7,9a-dimethyl-1-(4-methylphenyl)-8-phenyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-d][1,4]diazepin-7-ium-3-carboxylate |
| SMILES | CCOC(=O)C1=NN(c2ccc(C)cc2)[C@]2(C)CC(c3ccccc3)[NH+](C)CCN12 |
| InChI | InChI=1S/C24H30N4O2/c1-5-30-23(29)22-25-28(20-13-11-18(2)12-14-20)24(3)17-21(19-9-7-6-8-10-19)26(4)15-16-27(22)24/h6-14,21H,5,15-17H2,1-4H3/p+1/t21?,24-/m1/s1 |
| InChIKey | KCWUHYUAIRAHNB-MQNHUJCZSA-O |
| XLogP | 2.37 |
| TPSA | 49.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |