C26H22N2O4 — CID 163142665
3-[(1S,8S,15R,19S)-4-ethyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaen-17-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163142665) has the molecular formula C26H22N2O4 and a molecular weight of 426.47 g/mol. Its IUPAC name is 3-[(1S,8S,15R,19S)-4-ethyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaen-17-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[(1S,8S,15R,19S)-4-ethyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaen-17-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163142665 |
| Molecular Formula | C26H22N2O4 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 3-[(1S,8S,15R,19S)-4-ethyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaen-17-yl]-N-hydroxybenzeneamine oxide |
| SMILES | CCc1ccc2c(c1)[C@@H]1c3ccccc3[C@@H]2[C@@H]2C(=O)N(c3cccc([NH+]([O-])O)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C26H22N2O4/c1-2-14-10-11-19-20(12-14)22-18-9-4-3-8-17(18)21(19)23-24(22)26(30)27(25(23)29)15-6-5-7-16(13-15)28(31)32/h3-13,21-24,28,31H,2H2,1H3/t21-,22-,23-,24+/m0/s1 |
| InChIKey | KIZZLYPFFRAVNN-NEWJYFPISA-N |
| XLogP | 3.05 |
| TPSA | 85.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|