C29H28N4O10 — CID 163136357
3-[13-ethoxycarbonyl-10-[3-[hydroxy(oxido)azaniumyl]phenyl]-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl]-N-hydroxybenzeneamine oxide (PubChem CID 163136357) has the molecular formula C29H28N4O10 and a molecular weight of 592.56 g/mol. Its IUPAC name is 3-[13-ethoxycarbonyl-10-[3-[hydroxy(oxido)azaniumyl]phenyl]-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl]-N-hydroxybenzeneamine oxide.
| Compound Name | 3-[13-ethoxycarbonyl-10-[3-[hydroxy(oxido)azaniumyl]phenyl]-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163136357 |
| Molecular Formula | C29H28N4O10 |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | 3-[13-ethoxycarbonyl-10-[3-[hydroxy(oxido)azaniumyl]phenyl]-1,14-dimethyl-3,5,9,11-tetraoxo-4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradec-13-en-4-yl]-N-hydroxybenzeneamine oxide |
| SMILES | CCOC(=O)C1=C(C)C2C3C(=O)N(c4cccc([NH+]([O-])O)c4)C(=O)C3C1(C)C1C(=O)N(c3cccc([NH+]([O-])O)c3)C(=O)C21 |
| InChI | InChI=1S/C29H28N4O10/c1-4-43-28(38)21-13(2)18-19-22(26(36)30(24(19)34)14-7-5-9-16(11-14)32(39)40)29(21,3)23-20(18)25(35)31(27(23)37)15-8-6-10-17(12-15)33(41)42/h5-12,18-20,22-23,32-33,39,41H,4H2,1-3H3 |
| InChIKey | ICHWVKLYBVPGDY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 196.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|