C23H25O12+ — CID 163142706
[(2R,3S,4S,5R,6S)-6-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8aH-chromen-1-ium-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 163142706) has the molecular formula C23H25O12+ and a molecular weight of 493.44 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-6-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8aH-chromen-1-ium-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-6-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8aH-chromen-1-ium-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 163142706 |
| Molecular Formula | C23H25O12+ |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-6-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8aH-chromen-1-ium-3-yl]oxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC2=C(c3ccc(O)c(O)c3)[OH+]C3C=C(O)C=C(O)C3=C2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H24O12/c1-9(24)32-8-18-19(29)20(30)21(31)23(35-18)34-17-7-12-14(27)5-11(25)6-16(12)33-22(17)10-2-3-13(26)15(28)4-10/h2-7,16,18-21,23,25-31H,8H2,1H3/p+1/t16?,18-,19-,20+,21-,23-/m1/s1 |
| InChIKey | KJIDASOWGYOPFZ-FRVRGBRASA-O |
| XLogP | -0.11 |
| TPSA | 199.17 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|