C21H23O10+ — CID 163161455
3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-(4-hydroxy-3-methoxyphenyl)-8aH-chromen-1-ium-5,7-diol (PubChem CID 163161455) has the molecular formula C21H23O10+ and a molecular weight of 435.41 g/mol. Its IUPAC name is 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-(4-hydroxy-3-methoxyphenyl)-8aH-chromen-1-ium-5,7-diol.
| Compound Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-(4-hydroxy-3-methoxyphenyl)-8aH-chromen-1-ium-5,7-diol |
|---|---|
| PubChem CID | 163161455 |
| Molecular Formula | C21H23O10+ |
| Molecular Weight | 435.41 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-(4-hydroxy-3-methoxyphenyl)-8aH-chromen-1-ium-5,7-diol |
| SMILES | COc1cc(C2=C(OC3OC(CO)C(O)C3O)C=C3C(O)=CC(O)=CC3[OH+]2)ccc1O |
| InChI | InChI=1S/C21H22O10/c1-28-15-4-9(2-3-12(15)24)20-16(30-21-19(27)18(26)17(8-22)31-21)7-11-13(25)5-10(23)6-14(11)29-20/h2-7,14,17-19,21-27H,8H2,1H3/p+1 |
| InChIKey | RDYNTSQITMFGKZ-UHFFFAOYSA-O |
| XLogP | 0.26 |
| TPSA | 161.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.41 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|