C21H38BrNO4 — CID 163142926
1-[(2-bromo-4,5-dimethoxycyclohexyl)methyl]-6,7-dimethoxy-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline (PubChem CID 163142926) has the molecular formula C21H38BrNO4 and a molecular weight of 448.44 g/mol. Its IUPAC name is 1-[(2-bromo-4,5-dimethoxycyclohexyl)methyl]-6,7-dimethoxy-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline.
| Compound Name | 1-[(2-bromo-4,5-dimethoxycyclohexyl)methyl]-6,7-dimethoxy-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
|---|---|
| PubChem CID | 163142926 |
| Molecular Formula | C21H38BrNO4 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 1-[(2-bromo-4,5-dimethoxycyclohexyl)methyl]-6,7-dimethoxy-2-methyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline |
| SMILES | COC1CC(Br)C(CC2C3CC(OC)C(OC)CC3CCN2C)CC1OC |
| InChI | InChI=1S/C21H38BrNO4/c1-23-7-6-13-9-18(24-2)20(26-4)11-15(13)17(23)8-14-10-19(25-3)21(27-5)12-16(14)22/h13-21H,6-12H2,1-5H3 |
| InChIKey | IGTAELDDBRREKD-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|