About 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride
4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride (PubChem CID 44557964) has the molecular formula C14H30Cl2N2O2
and a molecular weight of 329.31 g/mol. Its IUPAC name is 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride.
Molecular Properties
| Compound Name | 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride |
| PubChem CID | 44557964 |
| Molecular Formula | C14H30Cl2N2O2 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride |
| SMILES | COC1CC(C2CCC(N)C(OC)C2)CCC1N.[Cl-].[Cl-].[H+].[H+] |
| InChI | InChI=1S/C14H28N2O2.2ClH/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;;/h9-14H,3-8,15-16H2,1-2H3;2*1H |
| InChIKey | YZKKKFKZCIVARG-UHFFFAOYSA-N |
| XLogP | -4.50 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride?
The IUPAC name of 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride (CID 44557964) is 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride.
What is the SMILES notation for 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride?
The canonical SMILES for 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride is COC1CC(C2CCC(N)C(OC)C2)CCC1N.[Cl-].[Cl-].[H+].[H+].
What is the InChIKey of 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride?
The InChIKey is YZKKKFKZCIVARG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28N2O2.2ClH/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;;/h9-14H,3-8,15-16H2,1-2H3;2*1H.
What are the key properties of 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride?
4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride has a molecular weight of 329.31 g/mol, XLogP of -4.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3-methoxycyclohexyl)-2-methoxycyclohexan-1-amine;hydron;dichloride is sourced from PubChem (CID 44557964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).