C30H54O6S3 — CID 138752565
(1S,5S,6R,8S,12S,15S,19S,20R,24R)-6,13,20,22,24,26-hexamethoxy-3,10,17-trithiatetracyclo[17.2.2.25,8.212,15]heptacosane (PubChem CID 138752565) has the molecular formula C30H54O6S3 and a molecular weight of 606.96 g/mol. Its IUPAC name is (1S,5S,6R,8S,12S,15S,19S,20R,24R)-6,13,20,22,24,26-hexamethoxy-3,10,17-trithiatetracyclo[17.2.2.25,8.212,15]heptacosane.
| Compound Name | (1S,5S,6R,8S,12S,15S,19S,20R,24R)-6,13,20,22,24,26-hexamethoxy-3,10,17-trithiatetracyclo[17.2.2.25,8.212,15]heptacosane |
|---|---|
| PubChem CID | 138752565 |
| Molecular Formula | C30H54O6S3 |
| Molecular Weight | 606.96 g/mol |
| Exact Mass | 606.31 |
| IUPAC Name | (1S,5S,6R,8S,12S,15S,19S,20R,24R)-6,13,20,22,24,26-hexamethoxy-3,10,17-trithiatetracyclo[17.2.2.25,8.212,15]heptacosane |
| SMILES | COC1C[C@@H]2CSC[C@H]3C[C@@H](OC)[C@@H](CSC[C@H]4CC(OC)[C@@H](CSC[C@H]1C[C@H]2OC)C[C@H]4OC)CC3OC |
| InChI | InChI=1S/C30H54O6S3/c1-31-25-7-20-14-38-16-22-10-30(36-6)24(12-29(22)35-5)18-39-17-23-11-27(33-3)21(9-28(23)34-4)15-37-13-19(25)8-26(20)32-2/h19-30H,7-18H2,1-6H3/t19-,20-,21-,22-,23-,24-,25-,26?,27-,28?,29-,30?/m1/s1 |
| InChIKey | JNDDDVGLKPCDNY-CVVULPSCSA-N |
| XLogP | 5.37 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.96 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |