About 4-methoxythiolan-3-ol
4-methoxythiolan-3-ol (PubChem CID 18953082) has the molecular formula C5H10O2S
and a molecular weight of 134.20 g/mol. Its IUPAC name is 4-methoxythiolan-3-ol.
Molecular Properties
| Compound Name | 4-methoxythiolan-3-ol |
| PubChem CID | 18953082 |
| Molecular Formula | C5H10O2S |
| Molecular Weight | 134.20 g/mol |
| Exact Mass | 134.04 |
| IUPAC Name | 4-methoxythiolan-3-ol |
| SMILES | COC1CSCC1O |
| InChI | InChI=1S/C5H10O2S/c1-7-5-3-8-2-4(5)6/h4-6H,2-3H2,1H3 |
| InChIKey | QQDQSUXCSVFYFE-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.20 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxythiolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxythiolan-3-ol?
The IUPAC name of 4-methoxythiolan-3-ol (CID 18953082) is 4-methoxythiolan-3-ol.
What is the SMILES notation for 4-methoxythiolan-3-ol?
The canonical SMILES for 4-methoxythiolan-3-ol is COC1CSCC1O.
What is the InChIKey of 4-methoxythiolan-3-ol?
The InChIKey is QQDQSUXCSVFYFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2S/c1-7-5-3-8-2-4(5)6/h4-6H,2-3H2,1H3.
What are the key properties of 4-methoxythiolan-3-ol?
4-methoxythiolan-3-ol has a molecular weight of 134.20 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxythiolan-3-ol is sourced from PubChem (CID 18953082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).