C15H17Cl2N3O3S2 — CID 163144340
4-[[3-[bis(2-chloroethyl)aminomethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-N-hydroxybenzeneamine oxide (PubChem CID 163144340) has the molecular formula C15H17Cl2N3O3S2 and a molecular weight of 422.36 g/mol. Its IUPAC name is 4-[[3-[bis(2-chloroethyl)aminomethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-N-hydroxybenzeneamine oxide.
| Compound Name | 4-[[3-[bis(2-chloroethyl)aminomethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163144340 |
| Molecular Formula | C15H17Cl2N3O3S2 |
| Molecular Weight | 422.36 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | 4-[[3-[bis(2-chloroethyl)aminomethyl]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-N-hydroxybenzeneamine oxide |
| SMILES | O=C1C(=Cc2ccc([NH+]([O-])O)cc2)SC(=S)N1CN(CCCl)CCCl |
| InChI | InChI=1S/C15H17Cl2N3O3S2/c16-5-7-18(8-6-17)10-19-14(21)13(25-15(19)24)9-11-1-3-12(4-2-11)20(22)23/h1-4,9,20,22H,5-8,10H2 |
| InChIKey | KYQKBGRSCCALMH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|