C21H29Cl2N3O5S2 — CID 6447805
3-[(5E)-5-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid;2-(2-hydroxyethylamino)ethanol (PubChem CID 6447805) has the molecular formula C21H29Cl2N3O5S2 and a molecular weight of 538.52 g/mol. Its IUPAC name is 3-[(5E)-5-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid;2-(2-hydroxyethylamino)ethanol.
| Compound Name | 3-[(5E)-5-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid;2-(2-hydroxyethylamino)ethanol |
|---|---|
| PubChem CID | 6447805 |
| Molecular Formula | C21H29Cl2N3O5S2 |
| Molecular Weight | 538.52 g/mol |
| Exact Mass | 537.09 |
| IUPAC Name | 3-[(5E)-5-[[4-[bis(2-chloroethyl)amino]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid;2-(2-hydroxyethylamino)ethanol |
| SMILES | O=C(O)CCN1C(=O)/C(=C\c2ccc(N(CCCl)CCCl)cc2)SC1=S.OCCNCCO |
| InChI | InChI=1S/C17H18Cl2N2O3S2.C4H11NO2/c18-6-9-20(10-7-19)13-3-1-12(2-4-13)11-14-16(24)21(17(25)26-14)8-5-15(22)23;6-3-1-5-2-4-7/h1-4,11H,5-10H2,(H,22,23);5-7H,1-4H2/b14-11+; |
| InChIKey | VSOKCKFCPCIACX-JHGYPSGKSA-N |
| XLogP | 2.21 |
| TPSA | 113.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|