C20H32O6 — CID 163145451
13-(hydroxymethyl)-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadec-8-ene-1,6,7,14-tetrol (PubChem CID 163145451) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is 13-(hydroxymethyl)-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadec-8-ene-1,6,7,14-tetrol.
| Compound Name | 13-(hydroxymethyl)-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadec-8-ene-1,6,7,14-tetrol |
|---|---|
| PubChem CID | 163145451 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 13-(hydroxymethyl)-2,5-dimethyl-8-propan-2-yl-15-oxatetracyclo[10.2.1.02,10.05,9]pentadec-8-ene-1,6,7,14-tetrol |
| SMILES | CC(C)C1=C2C3CC4OC(O)(C(O)C4CO)C3(C)CCC2(C)C(O)C1O |
| InChI | InChI=1S/C20H32O6/c1-9(2)13-14-11-7-12-10(8-21)16(23)20(25,26-12)19(11,4)6-5-18(14,3)17(24)15(13)22/h9-12,15-17,21-25H,5-8H2,1-4H3 |
| InChIKey | LJWOUIAICYRZKD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|