C30H28O13 — CID 163146411
2-(3,4-dihydroxyphenyl)-5-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]methyl]oxan-2-yl]oxychromen-7-one (PubChem CID 163146411) has the molecular formula C30H28O13 and a molecular weight of 596.54 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]methyl]oxan-2-yl]oxychromen-7-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]methyl]oxan-2-yl]oxychromen-7-one |
|---|---|
| PubChem CID | 163146411 |
| Molecular Formula | C30H28O13 |
| Molecular Weight | 596.54 g/mol |
| Exact Mass | 596.15 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]methyl]oxan-2-yl]oxychromen-7-one |
| SMILES | O=c1cc2oc(-c3ccc(O)c(O)c3)c(O[C@@H]3O[C@H](COC(O)C=Cc4ccc(O)cc4)[C@@H](O)[C@H](O)[C@H]3O)cc-2c(O)c1 |
| InChI | InChI=1S/C30H28O13/c31-16-5-1-14(2-6-16)3-8-25(36)40-13-24-26(37)27(38)28(39)30(43-24)42-23-12-18-20(34)10-17(32)11-22(18)41-29(23)15-4-7-19(33)21(35)9-15/h1-12,24-28,30-31,33-39H,13H2/t24-,25?,26-,27+,28-,30-/m1/s1 |
| InChIKey | XCCOITHNNPJFPD-QLUHHWRYSA-N |
| XLogP | 1.47 |
| TPSA | 219.74 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.54 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|