C31H29O13+ — CID 163191760
[3-(4-hydroxyphenyl)-1-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-oxochromen-3-yl]oxyoxan-2-yl]methoxy]prop-2-enylidene]oxidanium (PubChem CID 163191760) has the molecular formula C31H29O13+ and a molecular weight of 609.56 g/mol. Its IUPAC name is [3-(4-hydroxyphenyl)-1-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-oxochromen-3-yl]oxyoxan-2-yl]methoxy]prop-2-enylidene]oxidanium.
| Compound Name | [3-(4-hydroxyphenyl)-1-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-oxochromen-3-yl]oxyoxan-2-yl]methoxy]prop-2-enylidene]oxidanium |
|---|---|
| PubChem CID | 163191760 |
| Molecular Formula | C31H29O13+ |
| Molecular Weight | 609.56 g/mol |
| Exact Mass | 609.16 |
| IUPAC Name | [3-(4-hydroxyphenyl)-1-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-6-[5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-oxochromen-3-yl]oxyoxan-2-yl]methoxy]prop-2-enylidene]oxidanium |
| SMILES | [H]/[O+]=C(\C=Cc1ccc(O)cc1)OC[C@H]1OC(Oc2cc3c(O)cc(=O)cc-3oc2-c2ccc(O)c(OC)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C31H28O13/c1-40-23-10-16(5-8-20(23)34)30-24(13-19-21(35)11-18(33)12-22(19)42-30)43-31-29(39)28(38)27(37)25(44-31)14-41-26(36)9-4-15-2-6-17(32)7-3-15/h2-13,25,27-29,31-32,34-35,37-39H,14H2,1H3/p+1/t25-,27-,28+,29-,31?/m1/s1 |
| InChIKey | SHSFFNDBPKAVJH-RJBRRTDCSA-O |
| XLogP | 1.96 |
| TPSA | 209.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|