C30H52N2O6 — CID 163146555
6-amino-2-[4-(3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]hexanoic acid (PubChem CID 163146555) has the molecular formula C30H52N2O6 and a molecular weight of 536.75 g/mol. Its IUPAC name is 6-amino-2-[4-(3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]hexanoic acid.
| Compound Name | 6-amino-2-[4-(3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 163146555 |
| Molecular Formula | C30H52N2O6 |
| Molecular Weight | 536.75 g/mol |
| Exact Mass | 536.38 |
| IUPAC Name | 6-amino-2-[4-(3,6,7-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoylamino]hexanoic acid |
| SMILES | CC(CCC(=O)NC(CCCCN)C(=O)O)C1CCC2C3C(O)C(O)C4CC(O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C30H52N2O6/c1-17(7-10-24(34)32-23(28(37)38)6-4-5-15-31)19-8-9-20-25-21(12-14-29(19,20)2)30(3)13-11-18(33)16-22(30)26(35)27(25)36/h17-23,25-27,33,35-36H,4-16,31H2,1-3H3,(H,32,34)(H,37,38) |
| InChIKey | LUWMRRZFTCISAM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.75 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|