C24H24O10S — CID 163150116
methyl (2S)-4-hydroxy-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-5-oxo-3-(4-sulfooxyphenyl)furan-2-carboxylate (PubChem CID 163150116) has the molecular formula C24H24O10S and a molecular weight of 504.51 g/mol. Its IUPAC name is methyl (2S)-4-hydroxy-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-5-oxo-3-(4-sulfooxyphenyl)furan-2-carboxylate.
| Compound Name | methyl (2S)-4-hydroxy-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-5-oxo-3-(4-sulfooxyphenyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 163150116 |
| Molecular Formula | C24H24O10S |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | methyl (2S)-4-hydroxy-2-[[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]methyl]-5-oxo-3-(4-sulfooxyphenyl)furan-2-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccc(O)c(CC=C(C)C)c2)OC(=O)C(O)=C1c1ccc(OS(=O)(=O)O)cc1 |
| InChI | InChI=1S/C24H24O10S/c1-14(2)4-6-17-12-15(5-11-19(17)25)13-24(23(28)32-3)20(21(26)22(27)33-24)16-7-9-18(10-8-16)34-35(29,30)31/h4-5,7-12,25-26H,6,13H2,1-3H3,(H,29,30,31)/t24-/m0/s1 |
| InChIKey | NAMSCIVBELGNKF-DEOSSOPVSA-N |
| XLogP | 3.06 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|