C65H74N6O8 — CID 163152371
CID 163152371 (PubChem CID 163152371) has the molecular formula C65H74N6O8 and a molecular weight of 1067.34 g/mol.
| Compound Name | CID 163152371 |
|---|---|
| PubChem CID | 163152371 |
| Molecular Formula | C65H74N6O8 |
| Molecular Weight | 1067.34 g/mol |
| Exact Mass | 1066.56 |
| IUPAC Name | — |
| SMILES | CCc1cc2c([nH]1)N1CCNC[C@@H]1[C@@]1(CCC3(CCCC3)C1)c1ccc(c(N=C(N)N)c1)C[C@@H](CO)COc1c(OC)c(OCC[C@@H](O)/C=C/c3ccccc3)c3c(=O)cc(-c4ccc(O)cc4)oc3c1CCc1cccc-2c1 |
| InChI | InChI=1S/C65H74N6O8/c1-3-48-35-52-45-13-9-12-42(32-45)15-23-51-58-57(54(75)36-55(79-58)44-17-21-49(73)22-18-44)60(77-31-24-50(74)20-14-41-10-5-4-6-11-41)61(76-2)59(51)78-39-43(38-72)33-46-16-19-47(34-53(46)70-63(66)67)65(28-27-64(40-65)25-7-8-26-64)56-37-68-29-30-71(56)62(52)69-48/h4-6,9-14,16-22,32,34-36,43,50,56,68-69,72-74H,3,7-8,15,23-31,33,37-40H2,1-2H3,(H4,66,67,70)/b20-14+/t43-,50-,56+,65+/m0/s1 |
| InChIKey | NUZUIUDBFGMRAM-IAWDZYNPSA-N |
| XLogP | 10.27 |
| TPSA | 214.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 79 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.34 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|