C16H19N2O3+ — CID 163152372
dihydroxy-[4-(6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)phenyl]azanium (PubChem CID 163152372) has the molecular formula C16H19N2O3+ and a molecular weight of 287.34 g/mol. Its IUPAC name is dihydroxy-[4-(6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)phenyl]azanium.
| Compound Name | dihydroxy-[4-(6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)phenyl]azanium |
|---|---|
| PubChem CID | 163152372 |
| Molecular Formula | C16H19N2O3+ |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | dihydroxy-[4-(6-hydroxy-1-methyl-3,4-dihydro-2H-isoquinolin-1-yl)phenyl]azanium |
| SMILES | CC1(c2ccc([NH+](O)O)cc2)NCCc2cc(O)ccc21 |
| InChI | InChI=1S/C16H18N2O3/c1-16(12-2-4-13(5-3-12)18(20)21)15-7-6-14(19)10-11(15)8-9-17-16/h2-7,10,17,19-21H,8-9H2,1H3/p+1 |
| InChIKey | NVBYMEZFQTUECI-UHFFFAOYSA-O |
| XLogP | 1.10 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|