C32H58N2O6 — CID 163152756
2-[3-[4-[(2-aminopiperidin-4-yl)methyl]-1,2-dihydroxycyclopentyl]-1-hydroxypropyl]-7-(6-hydroxy-4-pentylcyclohex-2-en-1-yl)heptanoic acid (PubChem CID 163152756) has the molecular formula C32H58N2O6 and a molecular weight of 566.82 g/mol. Its IUPAC name is 2-[3-[4-[(2-aminopiperidin-4-yl)methyl]-1,2-dihydroxycyclopentyl]-1-hydroxypropyl]-7-(6-hydroxy-4-pentylcyclohex-2-en-1-yl)heptanoic acid.
| Compound Name | 2-[3-[4-[(2-aminopiperidin-4-yl)methyl]-1,2-dihydroxycyclopentyl]-1-hydroxypropyl]-7-(6-hydroxy-4-pentylcyclohex-2-en-1-yl)heptanoic acid |
|---|---|
| PubChem CID | 163152756 |
| Molecular Formula | C32H58N2O6 |
| Molecular Weight | 566.82 g/mol |
| Exact Mass | 566.43 |
| IUPAC Name | 2-[3-[4-[(2-aminopiperidin-4-yl)methyl]-1,2-dihydroxycyclopentyl]-1-hydroxypropyl]-7-(6-hydroxy-4-pentylcyclohex-2-en-1-yl)heptanoic acid |
| SMILES | CCCCCC1C=CC(CCCCCC(C(=O)O)C(O)CCC2(O)CC(CC3CCNC(N)C3)CC2O)C(O)C1 |
| InChI | InChI=1S/C32H58N2O6/c1-2-3-5-8-22-11-12-25(28(36)18-22)9-6-4-7-10-26(31(38)39)27(35)13-15-32(40)21-24(19-29(32)37)17-23-14-16-34-30(33)20-23/h11-12,22-30,34-37,40H,2-10,13-21,33H2,1H3,(H,38,39) |
| InChIKey | DIWUUZJBFZEEMN-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 156.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.82 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|