C29H51NO6 — CID 163009676
2-[3-[1,2-dihydroxy-4-(1H-pyrrol-3-ylmethyl)cyclopentyl]-1-hydroxypropyl]-9-hydroxyhexadecanoic acid (PubChem CID 163009676) has the molecular formula C29H51NO6 and a molecular weight of 509.73 g/mol. Its IUPAC name is 2-[3-[1,2-dihydroxy-4-(1H-pyrrol-3-ylmethyl)cyclopentyl]-1-hydroxypropyl]-9-hydroxyhexadecanoic acid.
| Compound Name | 2-[3-[1,2-dihydroxy-4-(1H-pyrrol-3-ylmethyl)cyclopentyl]-1-hydroxypropyl]-9-hydroxyhexadecanoic acid |
|---|---|
| PubChem CID | 163009676 |
| Molecular Formula | C29H51NO6 |
| Molecular Weight | 509.73 g/mol |
| Exact Mass | 509.37 |
| IUPAC Name | 2-[3-[1,2-dihydroxy-4-(1H-pyrrol-3-ylmethyl)cyclopentyl]-1-hydroxypropyl]-9-hydroxyhexadecanoic acid |
| SMILES | CCCCCCCC(O)CCCCCCC(C(=O)O)C(O)CCC1(O)CC(Cc2cc[nH]c2)CC1O |
| InChI | InChI=1S/C29H51NO6/c1-2-3-4-5-8-11-24(31)12-9-6-7-10-13-25(28(34)35)26(32)14-16-29(36)20-23(19-27(29)33)18-22-15-17-30-21-22/h15,17,21,23-27,30-33,36H,2-14,16,18-20H2,1H3,(H,34,35) |
| InChIKey | CBCNSDYSCMCZPA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.73 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|