C29H51NO5 — CID 162791856
9-hydroxy-2-[1-hydroxy-3-[1-hydroxy-2-(1H-pyrrol-2-ylmethyl)cyclopentyl]propyl]hexadecanoic acid (PubChem CID 162791856) has the molecular formula C29H51NO5 and a molecular weight of 493.73 g/mol. Its IUPAC name is 9-hydroxy-2-[1-hydroxy-3-[1-hydroxy-2-(1H-pyrrol-2-ylmethyl)cyclopentyl]propyl]hexadecanoic acid.
| Compound Name | 9-hydroxy-2-[1-hydroxy-3-[1-hydroxy-2-(1H-pyrrol-2-ylmethyl)cyclopentyl]propyl]hexadecanoic acid |
|---|---|
| PubChem CID | 162791856 |
| Molecular Formula | C29H51NO5 |
| Molecular Weight | 493.73 g/mol |
| Exact Mass | 493.38 |
| IUPAC Name | 9-hydroxy-2-[1-hydroxy-3-[1-hydroxy-2-(1H-pyrrol-2-ylmethyl)cyclopentyl]propyl]hexadecanoic acid |
| SMILES | CCCCCCCC(O)CCCCCCC(C(=O)O)C(O)CCC1(O)CCCC1Cc1ccc[nH]1 |
| InChI | InChI=1S/C29H51NO5/c1-2-3-4-5-8-15-25(31)16-9-6-7-10-17-26(28(33)34)27(32)18-20-29(35)19-11-13-23(29)22-24-14-12-21-30-24/h12,14,21,23,25-27,30-32,35H,2-11,13,15-20,22H2,1H3,(H,33,34) |
| InChIKey | VKYYAZSREGCIRM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 113.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.73 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|