C37H58NO5- — CID 162791851
9-hydroxy-2-[1-hydroxy-3-[1-hydroxy-2-[[5-(2-phenylethyl)pyrrol-1-id-2-yl]methyl]cyclopentyl]propyl]hexadecanoic acid (PubChem CID 162791851) has the molecular formula C37H58NO5- and a molecular weight of 596.87 g/mol. Its IUPAC name is 9-hydroxy-2-[1-hydroxy-3-[1-hydroxy-2-[[5-(2-phenylethyl)pyrrol-1-id-2-yl]methyl]cyclopentyl]propyl]hexadecanoic acid.
| Compound Name | 9-hydroxy-2-[1-hydroxy-3-[1-hydroxy-2-[[5-(2-phenylethyl)pyrrol-1-id-2-yl]methyl]cyclopentyl]propyl]hexadecanoic acid |
|---|---|
| PubChem CID | 162791851 |
| Molecular Formula | C37H58NO5- |
| Molecular Weight | 596.87 g/mol |
| Exact Mass | 596.43 |
| IUPAC Name | 9-hydroxy-2-[1-hydroxy-3-[1-hydroxy-2-[[5-(2-phenylethyl)pyrrol-1-id-2-yl]methyl]cyclopentyl]propyl]hexadecanoic acid |
| SMILES | CCCCCCCC(O)CCCCCCC(C(=O)O)C(O)CCC1(O)CCCC1Cc1ccc(CCc2ccccc2)[n-]1 |
| InChI | InChI=1S/C37H58NO5/c1-2-3-4-5-11-18-33(39)19-12-6-7-13-20-34(36(41)42)35(40)25-27-37(43)26-14-17-30(37)28-32-24-23-31(38-32)22-21-29-15-9-8-10-16-29/h8-10,15-16,23-24,30,33-35,39-40,43H,2-7,11-14,17-22,25-28H2,1H3,(H,41,42)/q-1 |
| InChIKey | XVOAXVQQYLZLDG-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 112.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.87 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|