C34H59NO5 — CID 163131431
(2S,9S)-9-hydroxy-2-[(1R)-1-hydroxy-3-[(1R,3R)-1-hydroxy-3-[1-(2H-pyrrol-4-yl)cyclohexyl]cyclopentyl]propyl]hexadecanoic acid (PubChem CID 163131431) has the molecular formula C34H59NO5 and a molecular weight of 561.85 g/mol. Its IUPAC name is (2S,9S)-9-hydroxy-2-[(1R)-1-hydroxy-3-[(1R,3R)-1-hydroxy-3-[1-(2H-pyrrol-4-yl)cyclohexyl]cyclopentyl]propyl]hexadecanoic acid.
| Compound Name | (2S,9S)-9-hydroxy-2-[(1R)-1-hydroxy-3-[(1R,3R)-1-hydroxy-3-[1-(2H-pyrrol-4-yl)cyclohexyl]cyclopentyl]propyl]hexadecanoic acid |
|---|---|
| PubChem CID | 163131431 |
| Molecular Formula | C34H59NO5 |
| Molecular Weight | 561.85 g/mol |
| Exact Mass | 561.44 |
| IUPAC Name | (2S,9S)-9-hydroxy-2-[(1R)-1-hydroxy-3-[(1R,3R)-1-hydroxy-3-[1-(2H-pyrrol-4-yl)cyclohexyl]cyclopentyl]propyl]hexadecanoic acid |
| SMILES | CCCCCCC[C@H](O)CCCCCC[C@H](C(=O)O)[C@H](O)CC[C@]1(O)CC[C@@H](C2(C3=CCN=C3)CCCCC2)C1 |
| InChI | InChI=1S/C34H59NO5/c1-2-3-4-5-9-14-29(36)15-10-6-7-11-16-30(32(38)39)31(37)18-23-33(40)22-17-27(25-33)34(20-12-8-13-21-34)28-19-24-35-26-28/h19,26-27,29-31,36-37,40H,2-18,20-25H2,1H3,(H,38,39)/t27-,29+,30+,31-,33-/m1/s1 |
| InChIKey | GHIAIWCJLSELKE-FLHDZCCQSA-N |
| XLogP | 7.38 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.85 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|