C35H52N2O5 — CID 162924482
(2S,9S)-9-hydroxy-2-[(1R)-1-hydroxy-3-[(1R,2S)-1-hydroxy-2-(pyrrolo[3,2-f]indol-2-ylmethyl)cyclopentyl]propyl]hexadecanoic acid (PubChem CID 162924482) has the molecular formula C35H52N2O5 and a molecular weight of 580.81 g/mol. Its IUPAC name is (2S,9S)-9-hydroxy-2-[(1R)-1-hydroxy-3-[(1R,2S)-1-hydroxy-2-(pyrrolo[3,2-f]indol-2-ylmethyl)cyclopentyl]propyl]hexadecanoic acid.
| Compound Name | (2S,9S)-9-hydroxy-2-[(1R)-1-hydroxy-3-[(1R,2S)-1-hydroxy-2-(pyrrolo[3,2-f]indol-2-ylmethyl)cyclopentyl]propyl]hexadecanoic acid |
|---|---|
| PubChem CID | 162924482 |
| Molecular Formula | C35H52N2O5 |
| Molecular Weight | 580.81 g/mol |
| Exact Mass | 580.39 |
| IUPAC Name | (2S,9S)-9-hydroxy-2-[(1R)-1-hydroxy-3-[(1R,2S)-1-hydroxy-2-(pyrrolo[3,2-f]indol-2-ylmethyl)cyclopentyl]propyl]hexadecanoic acid |
| SMILES | CCCCCCC[C@H](O)CCCCCC[C@H](C(=O)O)[C@H](O)CC[C@]1(O)CCC[C@H]1CC1=Nc2cc3c(cc2=C1)C=CN=3 |
| InChI | InChI=1S/C35H52N2O5/c1-2-3-4-5-8-13-29(38)14-9-6-7-10-15-30(34(40)41)33(39)16-19-35(42)18-11-12-27(35)23-28-22-26-21-25-17-20-36-31(25)24-32(26)37-28/h17,20-22,24,27,29-30,33,38-39,42H,2-16,18-19,23H2,1H3,(H,40,41)/t27-,29-,30-,33+,35+/m0/s1 |
| InChIKey | OSRQPURTEAIJPO-ZKHWPMMASA-N |
| XLogP | 5.98 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.81 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|