C40H58N2O6 — CID 162842359
3-[5-[[2-(4-carboxy-3,11-dihydroxyoctadecyl)-2-hydroxy-4-(2H-pyrrol-2-ylium-4-ylmethyl)cyclopentyl]methyl]-1H-pyrrol-2-yl]phenolate (PubChem CID 162842359) has the molecular formula C40H58N2O6 and a molecular weight of 662.91 g/mol. Its IUPAC name is 3-[5-[[2-(4-carboxy-3,11-dihydroxyoctadecyl)-2-hydroxy-4-(2H-pyrrol-2-ylium-4-ylmethyl)cyclopentyl]methyl]-1H-pyrrol-2-yl]phenolate.
| Compound Name | 3-[5-[[2-(4-carboxy-3,11-dihydroxyoctadecyl)-2-hydroxy-4-(2H-pyrrol-2-ylium-4-ylmethyl)cyclopentyl]methyl]-1H-pyrrol-2-yl]phenolate |
|---|---|
| PubChem CID | 162842359 |
| Molecular Formula | C40H58N2O6 |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.43 |
| IUPAC Name | 3-[5-[[2-(4-carboxy-3,11-dihydroxyoctadecyl)-2-hydroxy-4-(2H-pyrrol-2-ylium-4-ylmethyl)cyclopentyl]methyl]-1H-pyrrol-2-yl]phenolate |
| SMILES | CCCCCCCC(O)CCCCCCC(C(=O)O)C(O)CCC1(O)CC(CC2=C[CH+]N=C2)CC1Cc1ccc(-c2cccc([O-])c2)[nH]1 |
| InChI | InChI=1S/C40H58N2O6/c1-2-3-4-5-8-13-34(43)14-9-6-7-10-16-36(39(46)47)38(45)19-21-40(48)27-30(23-29-20-22-41-28-29)24-32(40)26-33-17-18-37(42-33)31-12-11-15-35(44)25-31/h11-12,15,17-18,20,22,25,28,30,32,34,36,38,42-43,45,48H,2-10,13-14,16,19,21,23-24,26-27H2,1H3,(H-,44,46,47) |
| InChIKey | LHAACXAPMBNBEM-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|