C38H60NO7- — CID 162791476
3-[5-[[(1S,2S)-2-[(3R,4S,11S)-4-carboxy-3,11-dihydroxyoctadecyl]-2-hydroxycyclopentyl]methyl]-1H-pyrrol-2-yl]-5-(3-hydroxypropyl)phenolate (PubChem CID 162791476) has the molecular formula C38H60NO7- and a molecular weight of 642.90 g/mol. Its IUPAC name is 3-[5-[[(1S,2S)-2-[(3R,4S,11S)-4-carboxy-3,11-dihydroxyoctadecyl]-2-hydroxycyclopentyl]methyl]-1H-pyrrol-2-yl]-5-(3-hydroxypropyl)phenolate.
| Compound Name | 3-[5-[[(1S,2S)-2-[(3R,4S,11S)-4-carboxy-3,11-dihydroxyoctadecyl]-2-hydroxycyclopentyl]methyl]-1H-pyrrol-2-yl]-5-(3-hydroxypropyl)phenolate |
|---|---|
| PubChem CID | 162791476 |
| Molecular Formula | C38H60NO7- |
| Molecular Weight | 642.90 g/mol |
| Exact Mass | 642.44 |
| IUPAC Name | 3-[5-[[(1S,2S)-2-[(3R,4S,11S)-4-carboxy-3,11-dihydroxyoctadecyl]-2-hydroxycyclopentyl]methyl]-1H-pyrrol-2-yl]-5-(3-hydroxypropyl)phenolate |
| SMILES | CCCCCCC[C@H](O)CCCCCC[C@H](C(=O)O)[C@H](O)CC[C@@]1(O)CCC[C@H]1Cc1ccc(-c2cc([O-])cc(CCCO)c2)[nH]1 |
| InChI | InChI=1S/C38H61NO7/c1-2-3-4-5-8-15-32(41)16-9-6-7-10-17-34(37(44)45)36(43)20-22-38(46)21-11-14-30(38)27-31-18-19-35(39-31)29-24-28(13-12-23-40)25-33(42)26-29/h18-19,24-26,30,32,34,36,39-43,46H,2-17,20-23,27H2,1H3,(H,44,45)/p-1/t30-,32-,34-,36+,38-/m0/s1 |
| InChIKey | RBENXHWHZNELMB-IVTZECCXSA-M |
| XLogP | 6.66 |
| TPSA | 157.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.90 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|