C16H29FN+ — CID 163155926
1-[(2-fluorocyclohexyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium (PubChem CID 163155926) has the molecular formula C16H29FN+ and a molecular weight of 254.41 g/mol. Its IUPAC name is 1-[(2-fluorocyclohexyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium.
| Compound Name | 1-[(2-fluorocyclohexyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium |
|---|---|
| PubChem CID | 163155926 |
| Molecular Formula | C16H29FN+ |
| Molecular Weight | 254.41 g/mol |
| Exact Mass | 254.23 |
| IUPAC Name | 1-[(2-fluorocyclohexyl)methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinolin-1-ium |
| SMILES | FC1CCCCC1C[NH+]1CCCC2CCCCC21 |
| InChI | InChI=1S/C16H28FN/c17-15-9-3-1-7-14(15)12-18-11-5-8-13-6-2-4-10-16(13)18/h13-16H,1-12H2/p+1 |
| InChIKey | XVKVHINZCXZSSV-UHFFFAOYSA-O |
| XLogP | 2.75 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |