C23H27NO4 — CID 163156476
2,9,10-triethoxy-6,13a-dihydro-5H-isoquinolino[2,1-b]isoquinolin-3-ol (PubChem CID 163156476) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2,9,10-triethoxy-6,13a-dihydro-5H-isoquinolino[2,1-b]isoquinolin-3-ol.
| Compound Name | 2,9,10-triethoxy-6,13a-dihydro-5H-isoquinolino[2,1-b]isoquinolin-3-ol |
|---|---|
| PubChem CID | 163156476 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2,9,10-triethoxy-6,13a-dihydro-5H-isoquinolino[2,1-b]isoquinolin-3-ol |
| SMILES | CCOc1cc2c(cc1O)CCN1C=c3c(OCC)c(OCC)ccc3=CC21 |
| InChI | InChI=1S/C23H27NO4/c1-4-26-21-8-7-15-11-19-17-13-22(27-5-2)20(25)12-16(17)9-10-24(19)14-18(15)23(21)28-6-3/h7-8,11-14,19,25H,4-6,9-10H2,1-3H3 |
| InChIKey | PHIJQDHVVSVVBK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |