C16H29N — CID 163157344
[(1S,3S,4R,6S,7R,9R)-1,7-dimethyl-4-propan-2-yl-9-tricyclo[4.3.1.03,7]decanyl]-methanidylazanium (PubChem CID 163157344) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is [(1S,3S,4R,6S,7R,9R)-1,7-dimethyl-4-propan-2-yl-9-tricyclo[4.3.1.03,7]decanyl]-methanidylazanium.
| Compound Name | [(1S,3S,4R,6S,7R,9R)-1,7-dimethyl-4-propan-2-yl-9-tricyclo[4.3.1.03,7]decanyl]-methanidylazanium |
|---|---|
| PubChem CID | 163157344 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | [(1S,3S,4R,6S,7R,9R)-1,7-dimethyl-4-propan-2-yl-9-tricyclo[4.3.1.03,7]decanyl]-methanidylazanium |
| SMILES | [CH2-][NH2+][C@@H]1C[C@]2(C)[C@H]3C[C@H](C(C)C)[C@@H]2C[C@]1(C)C3 |
| InChI | InChI=1S/C16H29N/c1-10(2)12-6-11-7-15(3)8-13(12)16(11,4)9-14(15)17-5/h10-14H,5-9,17H2,1-4H3/t11-,12+,13-,14+,15-,16+/m0/s1 |
| InChIKey | PQGGZLFBLWGVFE-XBORSJSESA-N |
| XLogP | 2.83 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|