C22H36O3 — CID 163023701
[(1R,2S,3S,5S,6R,9S,11S,13R,14S)-14-hydroxy-6,9,13-trimethyl-3-propan-2-yl-5-tetracyclo[7.5.0.02,6.011,13]tetradecanyl] acetate (PubChem CID 163023701) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is [(1R,2S,3S,5S,6R,9S,11S,13R,14S)-14-hydroxy-6,9,13-trimethyl-3-propan-2-yl-5-tetracyclo[7.5.0.02,6.011,13]tetradecanyl] acetate.
| Compound Name | [(1R,2S,3S,5S,6R,9S,11S,13R,14S)-14-hydroxy-6,9,13-trimethyl-3-propan-2-yl-5-tetracyclo[7.5.0.02,6.011,13]tetradecanyl] acetate |
|---|---|
| PubChem CID | 163023701 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | [(1R,2S,3S,5S,6R,9S,11S,13R,14S)-14-hydroxy-6,9,13-trimethyl-3-propan-2-yl-5-tetracyclo[7.5.0.02,6.011,13]tetradecanyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C(C)C)[C@H]2[C@H]3[C@H](O)[C@]4(C)C[C@@H]4C[C@]3(C)CC[C@]21C |
| InChI | InChI=1S/C22H36O3/c1-12(2)15-9-16(25-13(3)23)21(5)8-7-20(4)10-14-11-22(14,6)19(24)18(20)17(15)21/h12,14-19,24H,7-11H2,1-6H3/t14-,15-,16-,17-,18-,19-,20-,21-,22+/m0/s1 |
| InChIKey | QORJGWVZZQZTGR-DPZUCKTFSA-N |
| XLogP | 4.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |