C22H34O5 — CID 162947259
[(3R,4S,6R,7S,9S,10S,11R)-9,11-dihydroxy-3,10,14-trimethyl-13-oxo-6-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradec-1(14)-enyl] acetate (PubChem CID 162947259) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(3R,4S,6R,7S,9S,10S,11R)-9,11-dihydroxy-3,10,14-trimethyl-13-oxo-6-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradec-1(14)-enyl] acetate.
| Compound Name | [(3R,4S,6R,7S,9S,10S,11R)-9,11-dihydroxy-3,10,14-trimethyl-13-oxo-6-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradec-1(14)-enyl] acetate |
|---|---|
| PubChem CID | 162947259 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(3R,4S,6R,7S,9S,10S,11R)-9,11-dihydroxy-3,10,14-trimethyl-13-oxo-6-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradec-1(14)-enyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@H](C(C)C)[C@@H]2C[C@H](O)[C@H](C)[C@]3(O)CC(=O)C(C)=C3C[C@@]12C |
| InChI | InChI=1S/C22H34O5/c1-11(2)15-7-20(27-14(5)23)21(6)9-17-12(3)19(25)10-22(17,26)13(4)18(24)8-16(15)21/h11,13,15-16,18,20,24,26H,7-10H2,1-6H3/t13-,15+,16-,18-,20-,21+,22+/m0/s1 |
| InChIKey | FSHUIIVAVDOQGB-BHFBAPGTSA-N |
| XLogP | 3.03 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |