C22H32O4 — CID 162817627
[(3S,4S,6R,7S,11S)-6-hydroxy-3,10,14-trimethyl-13-oxo-6-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradeca-1(14),9-dienyl] acetate (PubChem CID 162817627) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [(3S,4S,6R,7S,11S)-6-hydroxy-3,10,14-trimethyl-13-oxo-6-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradeca-1(14),9-dienyl] acetate.
| Compound Name | [(3S,4S,6R,7S,11S)-6-hydroxy-3,10,14-trimethyl-13-oxo-6-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradeca-1(14),9-dienyl] acetate |
|---|---|
| PubChem CID | 162817627 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [(3S,4S,6R,7S,11S)-6-hydroxy-3,10,14-trimethyl-13-oxo-6-propan-2-yl-4-tricyclo[9.3.0.03,7]tetradeca-1(14),9-dienyl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@](O)(C(C)C)[C@H]2CC=C(C)[C@@H]3CC(=O)C(C)=C3C[C@]12C |
| InChI | InChI=1S/C22H32O4/c1-12(2)22(25)11-20(26-15(5)23)21(6)10-17-14(4)18(24)9-16(17)13(3)7-8-19(21)22/h7,12,16,19-20,25H,8-11H2,1-6H3/t16-,19-,20-,21-,22+/m0/s1 |
| InChIKey | YDMMAWOPEAEISR-ADNIJMRFSA-N |
| XLogP | 3.98 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|