C22H30O5 — CID 162936949
[(1S,7S,13R,14S)-7-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-3,8,16-trien-14-yl] acetate (PubChem CID 162936949) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is [(1S,7S,13R,14S)-7-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-3,8,16-trien-14-yl] acetate.
| Compound Name | [(1S,7S,13R,14S)-7-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-3,8,16-trien-14-yl] acetate |
|---|---|
| PubChem CID | 162936949 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | [(1S,7S,13R,14S)-7-hydroxy-4,9,13,17-tetramethyl-5-oxo-6-oxatricyclo[11.4.0.03,7]heptadeca-3,8,16-trien-14-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=C(C)[C@@H]2CC3=C(C)C(=O)O[C@@]3(O)C=C(C)CCC[C@@]12C |
| InChI | InChI=1S/C22H30O5/c1-13-7-6-10-21(5)17(14(2)8-9-19(21)26-16(4)23)11-18-15(3)20(24)27-22(18,25)12-13/h8,12,17,19,25H,6-7,9-11H2,1-5H3/t17-,19-,21+,22-/m0/s1 |
| InChIKey | XQNCZSAVXBHWSC-BZNRXQDOSA-N |
| XLogP | 3.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|