C15H20O5 — CID 162933298
8,9,9a-trihydroxy-3,5,8a-trimethyl-4a,7,8,9-tetrahydro-4H-benzo[f][1]benzofuran-2-one (PubChem CID 162933298) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is 8,9,9a-trihydroxy-3,5,8a-trimethyl-4a,7,8,9-tetrahydro-4H-benzo[f][1]benzofuran-2-one.
| Compound Name | 8,9,9a-trihydroxy-3,5,8a-trimethyl-4a,7,8,9-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 162933298 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 8,9,9a-trihydroxy-3,5,8a-trimethyl-4a,7,8,9-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
| SMILES | CC1=CCC(O)C2(C)C1CC1=C(C)C(=O)OC1(O)C2O |
| InChI | InChI=1S/C15H20O5/c1-7-4-5-11(16)14(3)9(7)6-10-8(2)12(17)20-15(10,19)13(14)18/h4,9,11,13,16,18-19H,5-6H2,1-3H3 |
| InChIKey | VLNOGWIBWSHOBD-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|