C15H22O4 — CID 38358020
(4aR,5S,8aS,9S,9aS)-9,9a-dihydroxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-2-one (PubChem CID 38358020) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (4aR,5S,8aS,9S,9aS)-9,9a-dihydroxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-2-one.
| Compound Name | (4aR,5S,8aS,9S,9aS)-9,9a-dihydroxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 38358020 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (4aR,5S,8aS,9S,9aS)-9,9a-dihydroxy-3,4a,5-trimethyl-5,6,7,8,8a,9-hexahydro-4H-benzo[f][1]benzofuran-2-one |
| SMILES | CC1=C2C[C@@]3(C)[C@H](CCC[C@@H]3C)[C@H](O)[C@@]2(O)OC1=O |
| InChI | InChI=1S/C15H22O4/c1-8-5-4-6-10-12(16)15(18)11(7-14(8,10)3)9(2)13(17)19-15/h8,10,12,16,18H,4-7H2,1-3H3/t8-,10+,12-,14+,15-/m0/s1 |
| InChIKey | WVFNARDJAJTRAI-YXBDIRAFSA-N |
| XLogP | 1.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |