C23H32O7 — CID 11668945
[(1R,7S,8E,13R,14S,16S,18R)-9-(hydroxymethyl)-7-methoxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadeca-3,8-dien-14-yl] acetate (PubChem CID 11668945) has the molecular formula C23H32O7 and a molecular weight of 420.50 g/mol. Its IUPAC name is [(1R,7S,8E,13R,14S,16S,18R)-9-(hydroxymethyl)-7-methoxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadeca-3,8-dien-14-yl] acetate.
| Compound Name | [(1R,7S,8E,13R,14S,16S,18R)-9-(hydroxymethyl)-7-methoxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadeca-3,8-dien-14-yl] acetate |
|---|---|
| PubChem CID | 11668945 |
| Molecular Formula | C23H32O7 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | [(1R,7S,8E,13R,14S,16S,18R)-9-(hydroxymethyl)-7-methoxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadeca-3,8-dien-14-yl] acetate |
| SMILES | CO[C@]12/C=C(/CO)CCC[C@@]3(C)[C@@H](OC(C)=O)C[C@@H]4O[C@]4(C)[C@@H]3CC1=C(C)C(=O)O2 |
| InChI | InChI=1S/C23H32O7/c1-13-16-9-17-21(3,18(28-14(2)25)10-19-22(17,4)29-19)8-6-7-15(12-24)11-23(16,27-5)30-20(13)26/h11,17-19,24H,6-10,12H2,1-5H3/b15-11+/t17-,18+,19+,21-,22-,23+/m1/s1 |
| InChIKey | GFMCNQBYZBGGKW-QGSKGATRSA-N |
| XLogP | 2.81 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|