C21H22O10 — CID 163157387
(2S,3R,4R,5R,6S)-2-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8aH-chromen-3-yl]oxy]-6-methyloxane-3,4,5-triol (PubChem CID 163157387) has the molecular formula C21H22O10 and a molecular weight of 434.40 g/mol. Its IUPAC name is (2S,3R,4R,5R,6S)-2-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8aH-chromen-3-yl]oxy]-6-methyloxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5R,6S)-2-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8aH-chromen-3-yl]oxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 163157387 |
| Molecular Formula | C21H22O10 |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | (2S,3R,4R,5R,6S)-2-[[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8aH-chromen-3-yl]oxy]-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@@H](OC2=C(c3ccc(O)c(O)c3)OC3C=C(O)C=C(O)C3=C2)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H22O10/c1-8-17(26)18(27)19(28)21(29-8)31-16-7-11-13(24)5-10(22)6-15(11)30-20(16)9-2-3-12(23)14(25)4-9/h2-8,15,17-19,21-28H,1H3/t8-,15?,17-,18+,19+,21-/m0/s1 |
| InChIKey | PQLMTXWZXOTRKW-IINLGYLJSA-N |
| XLogP | 0.83 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|