C21H22O11 — CID 163151476
(2R,3R,4S,5S)-2-[[2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxy-8aH-chromen-3-yl]oxy]oxane-3,4,5-triol (PubChem CID 163151476) has the molecular formula C21H22O11 and a molecular weight of 450.40 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-[[2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxy-8aH-chromen-3-yl]oxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S)-2-[[2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxy-8aH-chromen-3-yl]oxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163151476 |
| Molecular Formula | C21H22O11 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | (2R,3R,4S,5S)-2-[[2-(3,4-dihydroxy-5-methoxyphenyl)-5,7-dihydroxy-8aH-chromen-3-yl]oxy]oxane-3,4,5-triol |
| SMILES | COc1cc(C2=C(O[C@H]3OC[C@H](O)[C@H](O)[C@H]3O)C=C3C(O)=CC(O)=CC3O2)cc(O)c1O |
| InChI | InChI=1S/C21H22O11/c1-29-15-3-8(2-12(24)17(15)26)20-16(32-21-19(28)18(27)13(25)7-30-21)6-10-11(23)4-9(22)5-14(10)31-20/h2-6,13-14,18-19,21-28H,7H2,1H3/t13-,14?,18-,19+,21+/m0/s1 |
| InChIKey | NMHKKSCNKSRNNG-GRKDNERTSA-N |
| XLogP | 0.45 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|