C20H30O3 — CID 163159842
2,4a,7-trimethyl-2-(4-methyl-3-oxopentyl)-4,8,9,9a-tetrahydro-3H-benzo[7]annulene-1,5-dione (PubChem CID 163159842) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2,4a,7-trimethyl-2-(4-methyl-3-oxopentyl)-4,8,9,9a-tetrahydro-3H-benzo[7]annulene-1,5-dione.
| Compound Name | 2,4a,7-trimethyl-2-(4-methyl-3-oxopentyl)-4,8,9,9a-tetrahydro-3H-benzo[7]annulene-1,5-dione |
|---|---|
| PubChem CID | 163159842 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2,4a,7-trimethyl-2-(4-methyl-3-oxopentyl)-4,8,9,9a-tetrahydro-3H-benzo[7]annulene-1,5-dione |
| SMILES | CC1=CC(=O)C2(C)CCC(C)(CCC(=O)C(C)C)C(=O)C2CC1 |
| InChI | InChI=1S/C20H30O3/c1-13(2)16(21)8-9-19(4)10-11-20(5)15(18(19)23)7-6-14(3)12-17(20)22/h12-13,15H,6-11H2,1-5H3 |
| InChIKey | QORCSYCSEDDCTG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |